C9H13N3O2S3 — CID 106597383
3-(2-methylsulfanylethylsulfamoyl)pyridine-2-carbothioamide (PubChem CID 106597383) has the molecular formula C9H13N3O2S3 and a molecular weight of 291.42 g/mol. Its IUPAC name is 3-(2-methylsulfanylethylsulfamoyl)pyridine-2-carbothioamide.
| Compound Name | 3-(2-methylsulfanylethylsulfamoyl)pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 106597383 |
| Molecular Formula | C9H13N3O2S3 |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | 3-(2-methylsulfanylethylsulfamoyl)pyridine-2-carbothioamide |
| SMILES | CSCCNS(=O)(=O)c1cccnc1C(N)=S |
| InChI | InChI=1S/C9H13N3O2S3/c1-16-6-5-12-17(13,14)7-3-2-4-11-8(7)9(10)15/h2-4,12H,5-6H2,1H3,(H2,10,15) |
| InChIKey | MWIJQIBVGXKWCG-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|