C12H16N4O3S2 — CID 106597853
N-[2-[(2-carbamothioyl-3-pyridinyl)sulfonylamino]ethyl]cyclopropanecarboxamide (PubChem CID 106597853) has the molecular formula C12H16N4O3S2 and a molecular weight of 328.42 g/mol. Its IUPAC name is N-[2-[(2-carbamothioyl-3-pyridinyl)sulfonylamino]ethyl]cyclopropanecarboxamide.
| Compound Name | N-[2-[(2-carbamothioyl-3-pyridinyl)sulfonylamino]ethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 106597853 |
| Molecular Formula | C12H16N4O3S2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | N-[2-[(2-carbamothioyl-3-pyridinyl)sulfonylamino]ethyl]cyclopropanecarboxamide |
| SMILES | NC(=S)c1ncccc1S(=O)(=O)NCCNC(=O)C1CC1 |
| InChI | InChI=1S/C12H16N4O3S2/c13-11(20)10-9(2-1-5-14-10)21(18,19)16-7-6-15-12(17)8-3-4-8/h1-2,5,8,16H,3-4,6-7H2,(H2,13,20)(H,15,17) |
| InChIKey | DDRRSSQMISSRRM-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|