C11H15N3O4S2 — CID 106597141
ethyl 3-[(2-carbamothioyl-3-pyridinyl)sulfonylamino]propanoate (PubChem CID 106597141) has the molecular formula C11H15N3O4S2 and a molecular weight of 317.39 g/mol. Its IUPAC name is ethyl 3-[(2-carbamothioyl-3-pyridinyl)sulfonylamino]propanoate.
| Compound Name | ethyl 3-[(2-carbamothioyl-3-pyridinyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 106597141 |
| Molecular Formula | C11H15N3O4S2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | ethyl 3-[(2-carbamothioyl-3-pyridinyl)sulfonylamino]propanoate |
| SMILES | CCOC(=O)CCNS(=O)(=O)c1cccnc1C(N)=S |
| InChI | InChI=1S/C11H15N3O4S2/c1-2-18-9(15)5-7-14-20(16,17)8-4-3-6-13-10(8)11(12)19/h3-4,6,14H,2,5,7H2,1H3,(H2,12,19) |
| InChIKey | AMFUFOOOAFFVFI-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|