C14H20BrClN2O2S — CID 63494942
5-bromo-2-chloro-N-[(4-ethylcyclohexyl)methyl]pyridine-3-sulfonamide (PubChem CID 63494942) has the molecular formula C14H20BrClN2O2S and a molecular weight of 395.75 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[(4-ethylcyclohexyl)methyl]pyridine-3-sulfonamide.
| Compound Name | 5-bromo-2-chloro-N-[(4-ethylcyclohexyl)methyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 63494942 |
| Molecular Formula | C14H20BrClN2O2S |
| Molecular Weight | 395.75 g/mol |
| Exact Mass | 394.01 |
| IUPAC Name | 5-bromo-2-chloro-N-[(4-ethylcyclohexyl)methyl]pyridine-3-sulfonamide |
| SMILES | CCC1CCC(CNS(=O)(=O)c2cc(Br)cnc2Cl)CC1 |
| InChI | InChI=1S/C14H20BrClN2O2S/c1-2-10-3-5-11(6-4-10)8-18-21(19,20)13-7-12(15)9-17-14(13)16/h7,9-11,18H,2-6,8H2,1H3 |
| InChIKey | NYNBOZMGWGLBCB-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.75 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|