C12H17BrClN3O2S — CID 61059517
5-bromo-2-chloro-N-[(1-ethylpyrrolidin-3-yl)methyl]pyridine-3-sulfonamide (PubChem CID 61059517) has the molecular formula C12H17BrClN3O2S and a molecular weight of 382.71 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[(1-ethylpyrrolidin-3-yl)methyl]pyridine-3-sulfonamide.
| Compound Name | 5-bromo-2-chloro-N-[(1-ethylpyrrolidin-3-yl)methyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 61059517 |
| Molecular Formula | C12H17BrClN3O2S |
| Molecular Weight | 382.71 g/mol |
| Exact Mass | 380.99 |
| IUPAC Name | 5-bromo-2-chloro-N-[(1-ethylpyrrolidin-3-yl)methyl]pyridine-3-sulfonamide |
| SMILES | CCN1CCC(CNS(=O)(=O)c2cc(Br)cnc2Cl)C1 |
| InChI | InChI=1S/C12H17BrClN3O2S/c1-2-17-4-3-9(8-17)6-16-20(18,19)11-5-10(13)7-15-12(11)14/h5,7,9,16H,2-4,6,8H2,1H3 |
| InChIKey | WAYQTXKSPKALSB-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.71 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|