C10H14BrClN2O2S2 — CID 115899532
5-bromo-2-chloro-N-(1-methylsulfanylbutan-2-yl)pyridine-3-sulfonamide (PubChem CID 115899532) has the molecular formula C10H14BrClN2O2S2 and a molecular weight of 373.73 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-(1-methylsulfanylbutan-2-yl)pyridine-3-sulfonamide.
| Compound Name | 5-bromo-2-chloro-N-(1-methylsulfanylbutan-2-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 115899532 |
| Molecular Formula | C10H14BrClN2O2S2 |
| Molecular Weight | 373.73 g/mol |
| Exact Mass | 371.94 |
| IUPAC Name | 5-bromo-2-chloro-N-(1-methylsulfanylbutan-2-yl)pyridine-3-sulfonamide |
| SMILES | CCC(CSC)NS(=O)(=O)c1cc(Br)cnc1Cl |
| InChI | InChI=1S/C10H14BrClN2O2S2/c1-3-8(6-17-2)14-18(15,16)9-4-7(11)5-13-10(9)12/h4-5,8,14H,3,6H2,1-2H3 |
| InChIKey | WNWJTSBICXJZIP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.73 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|