C10H13Br2NO4S2 — CID 47350573
2,5-dibromo-N-(3-methylsulfonylpropyl)benzenesulfonamide (PubChem CID 47350573) has the molecular formula C10H13Br2NO4S2 and a molecular weight of 435.16 g/mol. Its IUPAC name is 2,5-dibromo-N-(3-methylsulfonylpropyl)benzenesulfonamide.
| Compound Name | 2,5-dibromo-N-(3-methylsulfonylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 47350573 |
| Molecular Formula | C10H13Br2NO4S2 |
| Molecular Weight | 435.16 g/mol |
| Exact Mass | 432.87 |
| IUPAC Name | 2,5-dibromo-N-(3-methylsulfonylpropyl)benzenesulfonamide |
| SMILES | CS(=O)(=O)CCCNS(=O)(=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C10H13Br2NO4S2/c1-18(14,15)6-2-5-13-19(16,17)10-7-8(11)3-4-9(10)12/h3-4,7,13H,2,5-6H2,1H3 |
| InChIKey | RSPNSAMTVJEMSW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.16 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|