C10H12Br3NO2S — CID 114297785
2,5-dibromo-N-(3-bromobutyl)benzenesulfonamide (PubChem CID 114297785) has the molecular formula C10H12Br3NO2S and a molecular weight of 449.99 g/mol. Its IUPAC name is 2,5-dibromo-N-(3-bromobutyl)benzenesulfonamide.
| Compound Name | 2,5-dibromo-N-(3-bromobutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 114297785 |
| Molecular Formula | C10H12Br3NO2S |
| Molecular Weight | 449.99 g/mol |
| Exact Mass | 446.81 |
| IUPAC Name | 2,5-dibromo-N-(3-bromobutyl)benzenesulfonamide |
| SMILES | CC(Br)CCNS(=O)(=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C10H12Br3NO2S/c1-7(11)4-5-14-17(15,16)10-6-8(12)2-3-9(10)13/h2-3,6-7,14H,4-5H2,1H3 |
| InChIKey | PABRQKDECQABSU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.99 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|