C10H14Br2N2O4S2 — CID 61125249
2-amino-4,6-dibromo-N-(3-methylsulfonylpropyl)benzenesulfonamide (PubChem CID 61125249) has the molecular formula C10H14Br2N2O4S2 and a molecular weight of 450.17 g/mol. Its IUPAC name is 2-amino-4,6-dibromo-N-(3-methylsulfonylpropyl)benzenesulfonamide.
| Compound Name | 2-amino-4,6-dibromo-N-(3-methylsulfonylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 61125249 |
| Molecular Formula | C10H14Br2N2O4S2 |
| Molecular Weight | 450.17 g/mol |
| Exact Mass | 447.88 |
| IUPAC Name | 2-amino-4,6-dibromo-N-(3-methylsulfonylpropyl)benzenesulfonamide |
| SMILES | CS(=O)(=O)CCCNS(=O)(=O)c1c(N)cc(Br)cc1Br |
| InChI | InChI=1S/C10H14Br2N2O4S2/c1-19(15,16)4-2-3-14-20(17,18)10-8(12)5-7(11)6-9(10)13/h5-6,14H,2-4,13H2,1H3 |
| InChIKey | XELVMXSZQYJNBM-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.17 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|