C10H11Br2N5O2S — CID 61126563
2-amino-4,6-dibromo-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]benzenesulfonamide (PubChem CID 61126563) has the molecular formula C10H11Br2N5O2S and a molecular weight of 425.11 g/mol. Its IUPAC name is 2-amino-4,6-dibromo-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]benzenesulfonamide.
| Compound Name | 2-amino-4,6-dibromo-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 61126563 |
| Molecular Formula | C10H11Br2N5O2S |
| Molecular Weight | 425.11 g/mol |
| Exact Mass | 422.90 |
| IUPAC Name | 2-amino-4,6-dibromo-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]benzenesulfonamide |
| SMILES | Cn1cnnc1CNS(=O)(=O)c1c(N)cc(Br)cc1Br |
| InChI | InChI=1S/C10H11Br2N5O2S/c1-17-5-14-16-9(17)4-15-20(18,19)10-7(12)2-6(11)3-8(10)13/h2-3,5,15H,4,13H2,1H3 |
| InChIKey | WUJABJGDXHXURO-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.11 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|