C10H11BrFN5O2S — CID 106491569
2-amino-5-bromo-4-fluoro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]benzenesulfonamide (PubChem CID 106491569) has the molecular formula C10H11BrFN5O2S and a molecular weight of 364.20 g/mol. Its IUPAC name is 2-amino-5-bromo-4-fluoro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]benzenesulfonamide.
| Compound Name | 2-amino-5-bromo-4-fluoro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106491569 |
| Molecular Formula | C10H11BrFN5O2S |
| Molecular Weight | 364.20 g/mol |
| Exact Mass | 362.98 |
| IUPAC Name | 2-amino-5-bromo-4-fluoro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]benzenesulfonamide |
| SMILES | Cn1cnnc1CNS(=O)(=O)c1cc(Br)c(F)cc1N |
| InChI | InChI=1S/C10H11BrFN5O2S/c1-17-5-14-16-10(17)4-15-20(18,19)9-2-6(11)7(12)3-8(9)13/h2-3,5,15H,4,13H2,1H3 |
| InChIKey | GJRXUEXCRUSTTO-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.20 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|