C11H11Br2N3O3S — CID 106369131
2-amino-4,6-dibromo-N-[(5-methyl-1,3-oxazol-2-yl)methyl]benzenesulfonamide (PubChem CID 106369131) has the molecular formula C11H11Br2N3O3S and a molecular weight of 425.10 g/mol. Its IUPAC name is 2-amino-4,6-dibromo-N-[(5-methyl-1,3-oxazol-2-yl)methyl]benzenesulfonamide.
| Compound Name | 2-amino-4,6-dibromo-N-[(5-methyl-1,3-oxazol-2-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106369131 |
| Molecular Formula | C11H11Br2N3O3S |
| Molecular Weight | 425.10 g/mol |
| Exact Mass | 422.89 |
| IUPAC Name | 2-amino-4,6-dibromo-N-[(5-methyl-1,3-oxazol-2-yl)methyl]benzenesulfonamide |
| SMILES | Cc1cnc(CNS(=O)(=O)c2c(N)cc(Br)cc2Br)o1 |
| InChI | InChI=1S/C11H11Br2N3O3S/c1-6-4-15-10(19-6)5-16-20(17,18)11-8(13)2-7(12)3-9(11)14/h2-4,16H,5,14H2,1H3 |
| InChIKey | XQVHJUYOKGMRMW-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.10 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|