C17H21Br2N3O2S — CID 113222919
2-amino-N-[3-[benzyl(methyl)amino]propyl]-4,6-dibromobenzenesulfonamide (PubChem CID 113222919) has the molecular formula C17H21Br2N3O2S and a molecular weight of 491.25 g/mol. Its IUPAC name is 2-amino-N-[3-[benzyl(methyl)amino]propyl]-4,6-dibromobenzenesulfonamide.
| Compound Name | 2-amino-N-[3-[benzyl(methyl)amino]propyl]-4,6-dibromobenzenesulfonamide |
|---|---|
| PubChem CID | 113222919 |
| Molecular Formula | C17H21Br2N3O2S |
| Molecular Weight | 491.25 g/mol |
| Exact Mass | 488.97 |
| IUPAC Name | 2-amino-N-[3-[benzyl(methyl)amino]propyl]-4,6-dibromobenzenesulfonamide |
| SMILES | CN(CCCNS(=O)(=O)c1c(N)cc(Br)cc1Br)Cc1ccccc1 |
| InChI | InChI=1S/C17H21Br2N3O2S/c1-22(12-13-6-3-2-4-7-13)9-5-8-21-25(23,24)17-15(19)10-14(18)11-16(17)20/h2-4,6-7,10-11,21H,5,8-9,12,20H2,1H3 |
| InChIKey | KRCLJWWUSLXNFN-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.25 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|