C17H20F2N2O2S — CID 47015302
N-[3-[benzyl(methyl)amino]propyl]-3,5-difluorobenzenesulfonamide (PubChem CID 47015302) has the molecular formula C17H20F2N2O2S and a molecular weight of 354.42 g/mol. Its IUPAC name is N-[3-[benzyl(methyl)amino]propyl]-3,5-difluorobenzenesulfonamide.
| Compound Name | N-[3-[benzyl(methyl)amino]propyl]-3,5-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 47015302 |
| Molecular Formula | C17H20F2N2O2S |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | N-[3-[benzyl(methyl)amino]propyl]-3,5-difluorobenzenesulfonamide |
| SMILES | CN(CCCNS(=O)(=O)c1cc(F)cc(F)c1)Cc1ccccc1 |
| InChI | InChI=1S/C17H20F2N2O2S/c1-21(13-14-6-3-2-4-7-14)9-5-8-20-24(22,23)17-11-15(18)10-16(19)12-17/h2-4,6-7,10-12,20H,5,8-9,13H2,1H3 |
| InChIKey | FDGSPSOGELFENH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|