C25H31N3O4S2 — CID 11584206
N-[3-[3-(benzenesulfonamido)propyl-benzylamino]propyl]benzenesulfonamide (PubChem CID 11584206) has the molecular formula C25H31N3O4S2 and a molecular weight of 501.67 g/mol. Its IUPAC name is N-[3-[3-(benzenesulfonamido)propyl-benzylamino]propyl]benzenesulfonamide.
| Compound Name | N-[3-[3-(benzenesulfonamido)propyl-benzylamino]propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 11584206 |
| Molecular Formula | C25H31N3O4S2 |
| Molecular Weight | 501.67 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | N-[3-[3-(benzenesulfonamido)propyl-benzylamino]propyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCCN(CCCNS(=O)(=O)c1ccccc1)Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H31N3O4S2/c29-33(30,24-14-6-2-7-15-24)26-18-10-20-28(22-23-12-4-1-5-13-23)21-11-19-27-34(31,32)25-16-8-3-9-17-25/h1-9,12-17,26-27H,10-11,18-22H2 |
| InChIKey | FMQRBAGIWCQXCT-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.67 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|