C19H26N2O2S — CID 110446606
N-[3-[benzyl(methyl)amino]propyl]-3,4-dimethylbenzenesulfonamide (PubChem CID 110446606) has the molecular formula C19H26N2O2S and a molecular weight of 346.50 g/mol. Its IUPAC name is N-[3-[benzyl(methyl)amino]propyl]-3,4-dimethylbenzenesulfonamide.
| Compound Name | N-[3-[benzyl(methyl)amino]propyl]-3,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 110446606 |
| Molecular Formula | C19H26N2O2S |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | N-[3-[benzyl(methyl)amino]propyl]-3,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCCN(C)Cc2ccccc2)cc1C |
| InChI | InChI=1S/C19H26N2O2S/c1-16-10-11-19(14-17(16)2)24(22,23)20-12-7-13-21(3)15-18-8-5-4-6-9-18/h4-6,8-11,14,20H,7,12-13,15H2,1-3H3 |
| InChIKey | XWHYMZBQXJYECH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|