C12H21BrN4O2S — CID 62641481
5-bromo-2-(ethylamino)-N-[2-[ethyl(methyl)amino]ethyl]pyridine-3-sulfonamide (PubChem CID 62641481) has the molecular formula C12H21BrN4O2S and a molecular weight of 365.30 g/mol. Its IUPAC name is 5-bromo-2-(ethylamino)-N-[2-[ethyl(methyl)amino]ethyl]pyridine-3-sulfonamide.
| Compound Name | 5-bromo-2-(ethylamino)-N-[2-[ethyl(methyl)amino]ethyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 62641481 |
| Molecular Formula | C12H21BrN4O2S |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | 5-bromo-2-(ethylamino)-N-[2-[ethyl(methyl)amino]ethyl]pyridine-3-sulfonamide |
| SMILES | CCNc1ncc(Br)cc1S(=O)(=O)NCCN(C)CC |
| InChI | InChI=1S/C12H21BrN4O2S/c1-4-14-12-11(8-10(13)9-15-12)20(18,19)16-6-7-17(3)5-2/h8-9,16H,4-7H2,1-3H3,(H,14,15) |
| InChIKey | GTWWJVZTVLCNAB-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |