C11H13BrF3N3O2S — CID 106217981
5-bromo-2-(ethylamino)-N-[1-(trifluoromethyl)cyclopropyl]pyridine-3-sulfonamide (PubChem CID 106217981) has the molecular formula C11H13BrF3N3O2S and a molecular weight of 388.21 g/mol. Its IUPAC name is 5-bromo-2-(ethylamino)-N-[1-(trifluoromethyl)cyclopropyl]pyridine-3-sulfonamide.
| Compound Name | 5-bromo-2-(ethylamino)-N-[1-(trifluoromethyl)cyclopropyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 106217981 |
| Molecular Formula | C11H13BrF3N3O2S |
| Molecular Weight | 388.21 g/mol |
| Exact Mass | 386.99 |
| IUPAC Name | 5-bromo-2-(ethylamino)-N-[1-(trifluoromethyl)cyclopropyl]pyridine-3-sulfonamide |
| SMILES | CCNc1ncc(Br)cc1S(=O)(=O)NC1(C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H13BrF3N3O2S/c1-2-16-9-8(5-7(12)6-17-9)21(19,20)18-10(3-4-10)11(13,14)15/h5-6,18H,2-4H2,1H3,(H,16,17) |
| InChIKey | ZPFAQIFTJHCWEL-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.21 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |