C9H7BrClF3N2O2S — CID 106211284
5-bromo-2-chloro-N-[1-(trifluoromethyl)cyclopropyl]pyridine-3-sulfonamide (PubChem CID 106211284) has the molecular formula C9H7BrClF3N2O2S and a molecular weight of 379.59 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[1-(trifluoromethyl)cyclopropyl]pyridine-3-sulfonamide.
| Compound Name | 5-bromo-2-chloro-N-[1-(trifluoromethyl)cyclopropyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 106211284 |
| Molecular Formula | C9H7BrClF3N2O2S |
| Molecular Weight | 379.59 g/mol |
| Exact Mass | 377.91 |
| IUPAC Name | 5-bromo-2-chloro-N-[1-(trifluoromethyl)cyclopropyl]pyridine-3-sulfonamide |
| SMILES | O=S(=O)(NC1(C(F)(F)F)CC1)c1cc(Br)cnc1Cl |
| InChI | InChI=1S/C9H7BrClF3N2O2S/c10-5-3-6(7(11)15-4-5)19(17,18)16-8(1-2-8)9(12,13)14/h3-4,16H,1-2H2 |
| InChIKey | CGFDEFPAMFTZJH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.59 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|