C14H24BrN3O2S — CID 106027676
5-bromo-2-(methylamino)-N-octan-4-ylpyridine-3-sulfonamide (PubChem CID 106027676) has the molecular formula C14H24BrN3O2S and a molecular weight of 378.34 g/mol. Its IUPAC name is 5-bromo-2-(methylamino)-N-octan-4-ylpyridine-3-sulfonamide.
| Compound Name | 5-bromo-2-(methylamino)-N-octan-4-ylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 106027676 |
| Molecular Formula | C14H24BrN3O2S |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 5-bromo-2-(methylamino)-N-octan-4-ylpyridine-3-sulfonamide |
| SMILES | CCCCC(CCC)NS(=O)(=O)c1cc(Br)cnc1NC |
| InChI | InChI=1S/C14H24BrN3O2S/c1-4-6-8-12(7-5-2)18-21(19,20)13-9-11(15)10-17-14(13)16-3/h9-10,12,18H,4-8H2,1-3H3,(H,16,17) |
| InChIKey | ZMRYYTIVZDXLJP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |