C11H17BrN4O3S — CID 106347101
2-[[5-bromo-2-(methylamino)-3-pyridinyl]sulfonylamino]-3-methylbutanamide (PubChem CID 106347101) has the molecular formula C11H17BrN4O3S and a molecular weight of 365.25 g/mol. Its IUPAC name is 2-[[5-bromo-2-(methylamino)-3-pyridinyl]sulfonylamino]-3-methylbutanamide.
| Compound Name | 2-[[5-bromo-2-(methylamino)-3-pyridinyl]sulfonylamino]-3-methylbutanamide |
|---|---|
| PubChem CID | 106347101 |
| Molecular Formula | C11H17BrN4O3S |
| Molecular Weight | 365.25 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | 2-[[5-bromo-2-(methylamino)-3-pyridinyl]sulfonylamino]-3-methylbutanamide |
| SMILES | CNc1ncc(Br)cc1S(=O)(=O)NC(C(N)=O)C(C)C |
| InChI | InChI=1S/C11H17BrN4O3S/c1-6(2)9(10(13)17)16-20(18,19)8-4-7(12)5-15-11(8)14-3/h4-6,9,16H,1-3H3,(H2,13,17)(H,14,15) |
| InChIKey | IYYOWZQFAOUVNE-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.25 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |