C12H14BrN3O3S — CID 119040585
2-[(5-bromo-2-cyanophenyl)sulfonylamino]-3-methylbutanamide (PubChem CID 119040585) has the molecular formula C12H14BrN3O3S and a molecular weight of 360.23 g/mol. Its IUPAC name is 2-[(5-bromo-2-cyanophenyl)sulfonylamino]-3-methylbutanamide.
| Compound Name | 2-[(5-bromo-2-cyanophenyl)sulfonylamino]-3-methylbutanamide |
|---|---|
| PubChem CID | 119040585 |
| Molecular Formula | C12H14BrN3O3S |
| Molecular Weight | 360.23 g/mol |
| Exact Mass | 358.99 |
| IUPAC Name | 2-[(5-bromo-2-cyanophenyl)sulfonylamino]-3-methylbutanamide |
| SMILES | CC(C)C(NS(=O)(=O)c1cc(Br)ccc1C#N)C(N)=O |
| InChI | InChI=1S/C12H14BrN3O3S/c1-7(2)11(12(15)17)16-20(18,19)10-5-9(13)4-3-8(10)6-14/h3-5,7,11,16H,1-2H3,(H2,15,17) |
| InChIKey | YXUDQSZVWYBFES-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 113.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.23 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |