C12H15Br2NO4S — CID 61173478
(2S)-2-[(2,5-dibromophenyl)sulfonylamino]-3-methylpentanoic acid (PubChem CID 61173478) has the molecular formula C12H15Br2NO4S and a molecular weight of 429.13 g/mol. Its IUPAC name is (2S)-2-[(2,5-dibromophenyl)sulfonylamino]-3-methylpentanoic acid.
| Compound Name | (2S)-2-[(2,5-dibromophenyl)sulfonylamino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 61173478 |
| Molecular Formula | C12H15Br2NO4S |
| Molecular Weight | 429.13 g/mol |
| Exact Mass | 426.91 |
| IUPAC Name | (2S)-2-[(2,5-dibromophenyl)sulfonylamino]-3-methylpentanoic acid |
| SMILES | CCC(C)[C@H](NS(=O)(=O)c1cc(Br)ccc1Br)C(=O)O |
| InChI | InChI=1S/C12H15Br2NO4S/c1-3-7(2)11(12(16)17)15-20(18,19)10-6-8(13)4-5-9(10)14/h4-7,11,15H,3H2,1-2H3,(H,16,17)/t7?,11-/m0/s1 |
| InChIKey | TYTHCSRGVKPFQS-QRIDDKLISA-N |
| XLogP | 2.99 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.13 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |