C13H21N3O3S — CID 106343844
2-[(3-amino-2,5-dimethylphenyl)sulfonylamino]-3-methylbutanamide (PubChem CID 106343844) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is 2-[(3-amino-2,5-dimethylphenyl)sulfonylamino]-3-methylbutanamide.
| Compound Name | 2-[(3-amino-2,5-dimethylphenyl)sulfonylamino]-3-methylbutanamide |
|---|---|
| PubChem CID | 106343844 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 2-[(3-amino-2,5-dimethylphenyl)sulfonylamino]-3-methylbutanamide |
| SMILES | Cc1cc(N)c(C)c(S(=O)(=O)NC(C(N)=O)C(C)C)c1 |
| InChI | InChI=1S/C13H21N3O3S/c1-7(2)12(13(15)17)16-20(18,19)11-6-8(3)5-10(14)9(11)4/h5-7,12,16H,14H2,1-4H3,(H2,15,17) |
| InChIKey | HHJRFESFRHXALV-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|