C10H15ClN2O5S3 — CID 97255208
(2S)-2-[(2-chloro-5-methylsulfonylthiophen-3-yl)sulfonylamino]-3-methylbutanamide (PubChem CID 97255208) has the molecular formula C10H15ClN2O5S3 and a molecular weight of 374.89 g/mol. Its IUPAC name is (2S)-2-[(2-chloro-5-methylsulfonylthiophen-3-yl)sulfonylamino]-3-methylbutanamide.
| Compound Name | (2S)-2-[(2-chloro-5-methylsulfonylthiophen-3-yl)sulfonylamino]-3-methylbutanamide |
|---|---|
| PubChem CID | 97255208 |
| Molecular Formula | C10H15ClN2O5S3 |
| Molecular Weight | 374.89 g/mol |
| Exact Mass | 373.98 |
| IUPAC Name | (2S)-2-[(2-chloro-5-methylsulfonylthiophen-3-yl)sulfonylamino]-3-methylbutanamide |
| SMILES | CC(C)[C@H](NS(=O)(=O)c1cc(S(C)(=O)=O)sc1Cl)C(N)=O |
| InChI | InChI=1S/C10H15ClN2O5S3/c1-5(2)8(10(12)14)13-21(17,18)6-4-7(19-9(6)11)20(3,15)16/h4-5,8,13H,1-3H3,(H2,12,14)/t8-/m0/s1 |
| InChIKey | INSWNGIVOZXBTQ-QMMMGPOBSA-N |
| XLogP | 0.59 |
| TPSA | 123.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.89 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |