C9H11BrClNO4S2 — CID 80577603
(2R)-2-[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]-3-methylbutanoic acid (PubChem CID 80577603) has the molecular formula C9H11BrClNO4S2 and a molecular weight of 376.68 g/mol. Its IUPAC name is (2R)-2-[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 80577603 |
| Molecular Formula | C9H11BrClNO4S2 |
| Molecular Weight | 376.68 g/mol |
| Exact Mass | 374.90 |
| IUPAC Name | (2R)-2-[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@@H](NS(=O)(=O)c1cc(Cl)c(Br)s1)C(=O)O |
| InChI | InChI=1S/C9H11BrClNO4S2/c1-4(2)7(9(13)14)12-18(15,16)6-3-5(11)8(10)17-6/h3-4,7,12H,1-2H3,(H,13,14)/t7-/m1/s1 |
| InChIKey | VJFAVTABTOWJIT-SSDOTTSWSA-N |
| XLogP | 2.55 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.68 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |