C11H16BrClN2O3S2 — CID 115685414
2-[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]-N-tert-butylpropanamide (PubChem CID 115685414) has the molecular formula C11H16BrClN2O3S2 and a molecular weight of 403.75 g/mol. Its IUPAC name is 2-[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]-N-tert-butylpropanamide.
| Compound Name | 2-[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]-N-tert-butylpropanamide |
|---|---|
| PubChem CID | 115685414 |
| Molecular Formula | C11H16BrClN2O3S2 |
| Molecular Weight | 403.75 g/mol |
| Exact Mass | 401.95 |
| IUPAC Name | 2-[(5-bromo-4-chlorothiophen-2-yl)sulfonylamino]-N-tert-butylpropanamide |
| SMILES | CC(NS(=O)(=O)c1cc(Cl)c(Br)s1)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C11H16BrClN2O3S2/c1-6(10(16)14-11(2,3)4)15-20(17,18)8-5-7(13)9(12)19-8/h5-6,15H,1-4H3,(H,14,16) |
| InChIKey | RKZNPTDNVZSNAV-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.75 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |