C6H5BrClNO3S2 — CID 80580140
N-(5-bromo-4-chlorothiophen-2-yl)sulfonylacetamide (PubChem CID 80580140) has the molecular formula C6H5BrClNO3S2 and a molecular weight of 318.60 g/mol. Its IUPAC name is N-(5-bromo-4-chlorothiophen-2-yl)sulfonylacetamide.
| Compound Name | N-(5-bromo-4-chlorothiophen-2-yl)sulfonylacetamide |
|---|---|
| PubChem CID | 80580140 |
| Molecular Formula | C6H5BrClNO3S2 |
| Molecular Weight | 318.60 g/mol |
| Exact Mass | 316.86 |
| IUPAC Name | N-(5-bromo-4-chlorothiophen-2-yl)sulfonylacetamide |
| SMILES | CC(=O)NS(=O)(=O)c1cc(Cl)c(Br)s1 |
| InChI | InChI=1S/C6H5BrClNO3S2/c1-3(10)9-14(11,12)5-2-4(8)6(7)13-5/h2H,1H3,(H,9,10) |
| InChIKey | TYRYDTXDPHMAOR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.60 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |