C10H4BrCl4NO2S2 — CID 80578641
5-bromo-4-chloro-N-(2,4,5-trichlorophenyl)thiophene-2-sulfonamide (PubChem CID 80578641) has the molecular formula C10H4BrCl4NO2S2 and a molecular weight of 456.00 g/mol. Its IUPAC name is 5-bromo-4-chloro-N-(2,4,5-trichlorophenyl)thiophene-2-sulfonamide.
| Compound Name | 5-bromo-4-chloro-N-(2,4,5-trichlorophenyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80578641 |
| Molecular Formula | C10H4BrCl4NO2S2 |
| Molecular Weight | 456.00 g/mol |
| Exact Mass | 452.76 |
| IUPAC Name | 5-bromo-4-chloro-N-(2,4,5-trichlorophenyl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1cc(Cl)c(Cl)cc1Cl)c1cc(Cl)c(Br)s1 |
| InChI | InChI=1S/C10H4BrCl4NO2S2/c11-10-7(15)3-9(19-10)20(17,18)16-8-2-5(13)4(12)1-6(8)14/h1-3,16H |
| InChIKey | LSYSVJNEBAAPHY-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.00 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|