C12H11BrClNO2S2 — CID 80578616
5-bromo-4-chloro-N-(2,4-dimethylphenyl)thiophene-2-sulfonamide (PubChem CID 80578616) has the molecular formula C12H11BrClNO2S2 and a molecular weight of 380.72 g/mol. Its IUPAC name is 5-bromo-4-chloro-N-(2,4-dimethylphenyl)thiophene-2-sulfonamide.
| Compound Name | 5-bromo-4-chloro-N-(2,4-dimethylphenyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80578616 |
| Molecular Formula | C12H11BrClNO2S2 |
| Molecular Weight | 380.72 g/mol |
| Exact Mass | 378.91 |
| IUPAC Name | 5-bromo-4-chloro-N-(2,4-dimethylphenyl)thiophene-2-sulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2cc(Cl)c(Br)s2)c(C)c1 |
| InChI | InChI=1S/C12H11BrClNO2S2/c1-7-3-4-10(8(2)5-7)15-19(16,17)11-6-9(14)12(13)18-11/h3-6,15H,1-2H3 |
| InChIKey | RPSPUPCLASTBRV-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.72 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |