C12H12FNO2S2 — CID 91969488
N-(2,4-dimethylphenyl)-5-fluorothiophene-2-sulfonamide (PubChem CID 91969488) has the molecular formula C12H12FNO2S2 and a molecular weight of 285.37 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-5-fluorothiophene-2-sulfonamide.
| Compound Name | N-(2,4-dimethylphenyl)-5-fluorothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 91969488 |
| Molecular Formula | C12H12FNO2S2 |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | N-(2,4-dimethylphenyl)-5-fluorothiophene-2-sulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(F)s2)c(C)c1 |
| InChI | InChI=1S/C12H12FNO2S2/c1-8-3-4-10(9(2)7-8)14-18(15,16)12-6-5-11(13)17-12/h3-7,14H,1-2H3 |
| InChIKey | FBAYNXRAFIMTNM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |