C10H4Br2Cl3NO2S2 — CID 107792917
5-bromo-N-(4-bromo-2,3-dichlorophenyl)-4-chlorothiophene-2-sulfonamide (PubChem CID 107792917) has the molecular formula C10H4Br2Cl3NO2S2 and a molecular weight of 500.45 g/mol. Its IUPAC name is 5-bromo-N-(4-bromo-2,3-dichlorophenyl)-4-chlorothiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-(4-bromo-2,3-dichlorophenyl)-4-chlorothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 107792917 |
| Molecular Formula | C10H4Br2Cl3NO2S2 |
| Molecular Weight | 500.45 g/mol |
| Exact Mass | 496.71 |
| IUPAC Name | 5-bromo-N-(4-bromo-2,3-dichlorophenyl)-4-chlorothiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Br)c(Cl)c1Cl)c1cc(Cl)c(Br)s1 |
| InChI | InChI=1S/C10H4Br2Cl3NO2S2/c11-4-1-2-6(9(15)8(4)14)16-20(17,18)7-3-5(13)10(12)19-7/h1-3,16H |
| InChIKey | AWEYNQMZHUJMRG-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.45 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|