C10H5Br2Cl2NO2S2 — CID 107792932
3-bromo-N-(4-bromo-2,3-dichlorophenyl)thiophene-2-sulfonamide (PubChem CID 107792932) has the molecular formula C10H5Br2Cl2NO2S2 and a molecular weight of 466.00 g/mol. Its IUPAC name is 3-bromo-N-(4-bromo-2,3-dichlorophenyl)thiophene-2-sulfonamide.
| Compound Name | 3-bromo-N-(4-bromo-2,3-dichlorophenyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 107792932 |
| Molecular Formula | C10H5Br2Cl2NO2S2 |
| Molecular Weight | 466.00 g/mol |
| Exact Mass | 462.75 |
| IUPAC Name | 3-bromo-N-(4-bromo-2,3-dichlorophenyl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Br)c(Cl)c1Cl)c1sccc1Br |
| InChI | InChI=1S/C10H5Br2Cl2NO2S2/c11-5-1-2-7(9(14)8(5)13)15-19(16,17)10-6(12)3-4-18-10/h1-4,15H |
| InChIKey | QQWVUIXYNMNFNO-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.00 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|