About 3-bromo-N-(4-bromo-2,6-dichlorophenyl)thiophene-2-sulfonamide
3-bromo-N-(4-bromo-2,6-dichlorophenyl)thiophene-2-sulfonamide (PubChem CID 61456465) has the molecular formula C10H5Br2Cl2NO2S2
and a molecular weight of 466.00 g/mol. Its IUPAC name is 3-bromo-N-(4-bromo-2,6-dichlorophenyl)thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 3-bromo-N-(4-bromo-2,6-dichlorophenyl)thiophene-2-sulfonamide |
| PubChem CID | 61456465 |
| Molecular Formula | C10H5Br2Cl2NO2S2 |
| Molecular Weight | 466.00 g/mol |
| Exact Mass | 462.75 |
| IUPAC Name | 3-bromo-N-(4-bromo-2,6-dichlorophenyl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1c(Cl)cc(Br)cc1Cl)c1sccc1Br |
| InChI | InChI=1S/C10H5Br2Cl2NO2S2/c11-5-3-7(13)9(8(14)4-5)15-19(16,17)10-6(12)1-2-18-10/h1-4,15H |
| InChIKey | XKNDLAOUKHXQFC-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.00 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-bromo-N-(4-bromo-2,6-dichlorophenyl)thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-N-(4-bromo-2,6-dichlorophenyl)thiophene-2-sulfonamide?
The IUPAC name of 3-bromo-N-(4-bromo-2,6-dichlorophenyl)thiophene-2-sulfonamide (CID 61456465) is 3-bromo-N-(4-bromo-2,6-dichlorophenyl)thiophene-2-sulfonamide.
What is the SMILES notation for 3-bromo-N-(4-bromo-2,6-dichlorophenyl)thiophene-2-sulfonamide?
The canonical SMILES for 3-bromo-N-(4-bromo-2,6-dichlorophenyl)thiophene-2-sulfonamide is O=S(=O)(Nc1c(Cl)cc(Br)cc1Cl)c1sccc1Br.
What is the InChIKey of 3-bromo-N-(4-bromo-2,6-dichlorophenyl)thiophene-2-sulfonamide?
The InChIKey is XKNDLAOUKHXQFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5Br2Cl2NO2S2/c11-5-3-7(13)9(8(14)4-5)15-19(16,17)10-6(12)1-2-18-10/h1-4,15H.
What are the key properties of 3-bromo-N-(4-bromo-2,6-dichlorophenyl)thiophene-2-sulfonamide?
3-bromo-N-(4-bromo-2,6-dichlorophenyl)thiophene-2-sulfonamide has a molecular weight of 466.00 g/mol, XLogP of 5.38, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-N-(4-bromo-2,6-dichlorophenyl)thiophene-2-sulfonamide is sourced from PubChem (CID 61456465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).