C11H7BrClNO4S2 — CID 61458150
5-[(3-bromothiophen-2-yl)sulfonylamino]-2-chlorobenzoic acid (PubChem CID 61458150) has the molecular formula C11H7BrClNO4S2 and a molecular weight of 396.67 g/mol. Its IUPAC name is 5-[(3-bromothiophen-2-yl)sulfonylamino]-2-chlorobenzoic acid.
| Compound Name | 5-[(3-bromothiophen-2-yl)sulfonylamino]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 61458150 |
| Molecular Formula | C11H7BrClNO4S2 |
| Molecular Weight | 396.67 g/mol |
| Exact Mass | 394.87 |
| IUPAC Name | 5-[(3-bromothiophen-2-yl)sulfonylamino]-2-chlorobenzoic acid |
| SMILES | O=C(O)c1cc(NS(=O)(=O)c2sccc2Br)ccc1Cl |
| InChI | InChI=1S/C11H7BrClNO4S2/c12-8-3-4-19-11(8)20(17,18)14-6-1-2-9(13)7(5-6)10(15)16/h1-5,14H,(H,15,16) |
| InChIKey | RGAUOZRDUQXVKB-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.67 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |