C10H9BrN2O4S3 — CID 61063289
3-bromo-N-(4-sulfamoylphenyl)thiophene-2-sulfonamide (PubChem CID 61063289) has the molecular formula C10H9BrN2O4S3 and a molecular weight of 397.30 g/mol. Its IUPAC name is 3-bromo-N-(4-sulfamoylphenyl)thiophene-2-sulfonamide.
| Compound Name | 3-bromo-N-(4-sulfamoylphenyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 61063289 |
| Molecular Formula | C10H9BrN2O4S3 |
| Molecular Weight | 397.30 g/mol |
| Exact Mass | 395.89 |
| IUPAC Name | 3-bromo-N-(4-sulfamoylphenyl)thiophene-2-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc(NS(=O)(=O)c2sccc2Br)cc1 |
| InChI | InChI=1S/C10H9BrN2O4S3/c11-9-5-6-18-10(9)20(16,17)13-7-1-3-8(4-2-7)19(12,14)15/h1-6,13H,(H2,12,14,15) |
| InChIKey | JJFLXFPAUYTZMI-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.30 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |