C11H11BrN2O4S3 — CID 61063182
3-bromo-N-(2-methyl-5-sulfamoylphenyl)thiophene-2-sulfonamide (PubChem CID 61063182) has the molecular formula C11H11BrN2O4S3 and a molecular weight of 411.32 g/mol. Its IUPAC name is 3-bromo-N-(2-methyl-5-sulfamoylphenyl)thiophene-2-sulfonamide.
| Compound Name | 3-bromo-N-(2-methyl-5-sulfamoylphenyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 61063182 |
| Molecular Formula | C11H11BrN2O4S3 |
| Molecular Weight | 411.32 g/mol |
| Exact Mass | 409.91 |
| IUPAC Name | 3-bromo-N-(2-methyl-5-sulfamoylphenyl)thiophene-2-sulfonamide |
| SMILES | Cc1ccc(S(N)(=O)=O)cc1NS(=O)(=O)c1sccc1Br |
| InChI | InChI=1S/C11H11BrN2O4S3/c1-7-2-3-8(20(13,15)16)6-10(7)14-21(17,18)11-9(12)4-5-19-11/h2-6,14H,1H3,(H2,13,15,16) |
| InChIKey | FDCYJJPUTSBNBS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |