C10H10BrN3O4S3 — CID 61062460
3-bromo-N-[3-(sulfamoylamino)phenyl]thiophene-2-sulfonamide (PubChem CID 61062460) has the molecular formula C10H10BrN3O4S3 and a molecular weight of 412.31 g/mol. Its IUPAC name is 3-bromo-N-[3-(sulfamoylamino)phenyl]thiophene-2-sulfonamide.
| Compound Name | 3-bromo-N-[3-(sulfamoylamino)phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 61062460 |
| Molecular Formula | C10H10BrN3O4S3 |
| Molecular Weight | 412.31 g/mol |
| Exact Mass | 410.90 |
| IUPAC Name | 3-bromo-N-[3-(sulfamoylamino)phenyl]thiophene-2-sulfonamide |
| SMILES | NS(=O)(=O)Nc1cccc(NS(=O)(=O)c2sccc2Br)c1 |
| InChI | InChI=1S/C10H10BrN3O4S3/c11-9-4-5-19-10(9)20(15,16)13-7-2-1-3-8(6-7)14-21(12,17)18/h1-6,13-14H,(H2,12,17,18) |
| InChIKey | SFCHHAXFEBAAQA-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |