C10H5BrF3NO2S2 — CID 55119423
3-bromo-N-(3,4,5-trifluorophenyl)thiophene-2-sulfonamide (PubChem CID 55119423) has the molecular formula C10H5BrF3NO2S2 and a molecular weight of 372.19 g/mol. Its IUPAC name is 3-bromo-N-(3,4,5-trifluorophenyl)thiophene-2-sulfonamide.
| Compound Name | 3-bromo-N-(3,4,5-trifluorophenyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 55119423 |
| Molecular Formula | C10H5BrF3NO2S2 |
| Molecular Weight | 372.19 g/mol |
| Exact Mass | 370.89 |
| IUPAC Name | 3-bromo-N-(3,4,5-trifluorophenyl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1cc(F)c(F)c(F)c1)c1sccc1Br |
| InChI | InChI=1S/C10H5BrF3NO2S2/c11-6-1-2-18-10(6)19(16,17)15-5-3-7(12)9(14)8(13)4-5/h1-4,15H |
| InChIKey | QJORJTVFJHLNDF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.19 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|