C12H7Cl3N2O4S — CID 51133066
2-chloro-5-[(2,6-dichloro-3-pyridinyl)sulfonylamino]benzoic acid (PubChem CID 51133066) has the molecular formula C12H7Cl3N2O4S and a molecular weight of 381.62 g/mol. Its IUPAC name is 2-chloro-5-[(2,6-dichloro-3-pyridinyl)sulfonylamino]benzoic acid.
| Compound Name | 2-chloro-5-[(2,6-dichloro-3-pyridinyl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 51133066 |
| Molecular Formula | C12H7Cl3N2O4S |
| Molecular Weight | 381.62 g/mol |
| Exact Mass | 379.92 |
| IUPAC Name | 2-chloro-5-[(2,6-dichloro-3-pyridinyl)sulfonylamino]benzoic acid |
| SMILES | O=C(O)c1cc(NS(=O)(=O)c2ccc(Cl)nc2Cl)ccc1Cl |
| InChI | InChI=1S/C12H7Cl3N2O4S/c13-8-2-1-6(5-7(8)12(18)19)17-22(20,21)9-3-4-10(14)16-11(9)15/h1-5,17H,(H,18,19) |
| InChIKey | YZHTWKRDKPQZQP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.62 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|