2,4-dichloro-5-[(4-methoxyphenyl)sulfamoyl]benzoic acid

C14H11Cl2NO5S — CID 992252

IUPAC2,4-dichloro-5-[(4-methoxyphenyl)sulfamoyl]benzoic acid
SMILESCOc1ccc(NS(=O)(=O)c2cc(C(=O)O)c(Cl)cc2Cl)cc1
InChIInChI=1S/C14H11Cl2NO5S/c1-22-9-4-2-8(3-5-9)17-23(20,21)13-6-10(14(18)19)11(15)7-12(13)16/h2-7,17H,1H3,(H,18,19)
InChIKeyNRPBJEMEHKHKFB-UHFFFAOYSA-N
MW376.22 g/mol
LogP3.50
Rot. Bonds5

About 2,4-dichloro-5-[(4-methoxyphenyl)sulfamoyl]benzoic acid

2,4-dichloro-5-[(4-methoxyphenyl)sulfamoyl]benzoic acid (PubChem CID 992252) has the molecular formula C14H11Cl2NO5S and a molecular weight of 376.22 g/mol. Its IUPAC name is 2,4-dichloro-5-[(4-methoxyphenyl)sulfamoyl]benzoic acid.

Molecular Properties

Compound Name2,4-dichloro-5-[(4-methoxyphenyl)sulfamoyl]benzoic acid
PubChem CID992252
Molecular FormulaC14H11Cl2NO5S
Molecular Weight376.22 g/mol
Exact Mass374.97
IUPAC Name2,4-dichloro-5-[(4-methoxyphenyl)sulfamoyl]benzoic acid
SMILESCOc1ccc(NS(=O)(=O)c2cc(C(=O)O)c(Cl)cc2Cl)cc1
InChIInChI=1S/C14H11Cl2NO5S/c1-22-9-4-2-8(3-5-9)17-23(20,21)13-6-10(14(18)19)11(15)7-12(13)16/h2-7,17H,1H3,(H,18,19)
InChIKeyNRPBJEMEHKHKFB-UHFFFAOYSA-N
XLogP3.50
TPSA92.70 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500376.22
LogP ≤ 53.50
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2,4-dichloro-5-[(4-methoxyphenyl)sulfamoyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4-dichloro-5-[(4-methoxyphenyl)sulfamoyl]benzoic acid?
The IUPAC name of 2,4-dichloro-5-[(4-methoxyphenyl)sulfamoyl]benzoic acid (CID 992252) is 2,4-dichloro-5-[(4-methoxyphenyl)sulfamoyl]benzoic acid.
What is the SMILES notation for 2,4-dichloro-5-[(4-methoxyphenyl)sulfamoyl]benzoic acid?
The canonical SMILES for 2,4-dichloro-5-[(4-methoxyphenyl)sulfamoyl]benzoic acid is COc1ccc(NS(=O)(=O)c2cc(C(=O)O)c(Cl)cc2Cl)cc1.
What is the InChIKey of 2,4-dichloro-5-[(4-methoxyphenyl)sulfamoyl]benzoic acid?
The InChIKey is NRPBJEMEHKHKFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11Cl2NO5S/c1-22-9-4-2-8(3-5-9)17-23(20,21)13-6-10(14(18)19)11(15)7-12(13)16/h2-7,17H,1H3,(H,18,19).
What are the key properties of 2,4-dichloro-5-[(4-methoxyphenyl)sulfamoyl]benzoic acid?
2,4-dichloro-5-[(4-methoxyphenyl)sulfamoyl]benzoic acid has a molecular weight of 376.22 g/mol, XLogP of 3.50, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloro-5-[(4-methoxyphenyl)sulfamoyl]benzoic acid is sourced from PubChem (CID 992252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).