C15H10Cl2N2O4S2 — CID 10432094
2,4-dichloro-5-[(2-methyl-1,3-benzothiazol-5-yl)sulfamoyl]benzoic acid (PubChem CID 10432094) has the molecular formula C15H10Cl2N2O4S2 and a molecular weight of 417.30 g/mol. Its IUPAC name is 2,4-dichloro-5-[(2-methyl-1,3-benzothiazol-5-yl)sulfamoyl]benzoic acid.
| Compound Name | 2,4-dichloro-5-[(2-methyl-1,3-benzothiazol-5-yl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 10432094 |
| Molecular Formula | C15H10Cl2N2O4S2 |
| Molecular Weight | 417.30 g/mol |
| Exact Mass | 415.95 |
| IUPAC Name | 2,4-dichloro-5-[(2-methyl-1,3-benzothiazol-5-yl)sulfamoyl]benzoic acid |
| SMILES | Cc1nc2cc(NS(=O)(=O)c3cc(C(=O)O)c(Cl)cc3Cl)ccc2s1 |
| InChI | InChI=1S/C15H10Cl2N2O4S2/c1-7-18-12-4-8(2-3-13(12)24-7)19-25(22,23)14-5-9(15(20)21)10(16)6-11(14)17/h2-6,19H,1H3,(H,20,21) |
| InChIKey | LUXYFRHNNNOWFF-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.30 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |