C12H8Cl2N2O4S — CID 29050395
2,4-dichloro-5-(pyridin-4-ylsulfamoyl)benzoic acid (PubChem CID 29050395) has the molecular formula C12H8Cl2N2O4S and a molecular weight of 347.18 g/mol. Its IUPAC name is 2,4-dichloro-5-(pyridin-4-ylsulfamoyl)benzoic acid.
| Compound Name | 2,4-dichloro-5-(pyridin-4-ylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 29050395 |
| Molecular Formula | C12H8Cl2N2O4S |
| Molecular Weight | 347.18 g/mol |
| Exact Mass | 345.96 |
| IUPAC Name | 2,4-dichloro-5-(pyridin-4-ylsulfamoyl)benzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)Nc2ccncc2)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H8Cl2N2O4S/c13-9-6-10(14)11(5-8(9)12(17)18)21(19,20)16-7-1-3-15-4-2-7/h1-6H,(H,15,16)(H,17,18) |
| InChIKey | AWENDAINCBTVJD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.18 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |