C14H11Cl2NO4S2 — CID 2473332
2,4-dichloro-5-[(2-methylsulfanylphenyl)sulfamoyl]benzoic acid (PubChem CID 2473332) has the molecular formula C14H11Cl2NO4S2 and a molecular weight of 392.29 g/mol. Its IUPAC name is 2,4-dichloro-5-[(2-methylsulfanylphenyl)sulfamoyl]benzoic acid.
| Compound Name | 2,4-dichloro-5-[(2-methylsulfanylphenyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 2473332 |
| Molecular Formula | C14H11Cl2NO4S2 |
| Molecular Weight | 392.29 g/mol |
| Exact Mass | 390.95 |
| IUPAC Name | 2,4-dichloro-5-[(2-methylsulfanylphenyl)sulfamoyl]benzoic acid |
| SMILES | CSc1ccccc1NS(=O)(=O)c1cc(C(=O)O)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H11Cl2NO4S2/c1-22-12-5-3-2-4-11(12)17-23(20,21)13-6-8(14(18)19)9(15)7-10(13)16/h2-7,17H,1H3,(H,18,19) |
| InChIKey | HOECHEHBLAPWPT-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.29 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |