C11H7Cl2NO4S2 — CID 43090882
2-[(2,5-dichlorothiophen-3-yl)sulfonylamino]benzoic acid (PubChem CID 43090882) has the molecular formula C11H7Cl2NO4S2 and a molecular weight of 352.22 g/mol. Its IUPAC name is 2-[(2,5-dichlorothiophen-3-yl)sulfonylamino]benzoic acid.
| Compound Name | 2-[(2,5-dichlorothiophen-3-yl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 43090882 |
| Molecular Formula | C11H7Cl2NO4S2 |
| Molecular Weight | 352.22 g/mol |
| Exact Mass | 350.92 |
| IUPAC Name | 2-[(2,5-dichlorothiophen-3-yl)sulfonylamino]benzoic acid |
| SMILES | O=C(O)c1ccccc1NS(=O)(=O)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C11H7Cl2NO4S2/c12-9-5-8(10(13)19-9)20(17,18)14-7-4-2-1-3-6(7)11(15)16/h1-5,14H,(H,15,16) |
| InChIKey | NXBUSTPNMHNOFO-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.22 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |