C10H6Cl3NO3S2 — CID 81433543
2,5-dichloro-N-(4-chloro-2-hydroxyphenyl)thiophene-3-sulfonamide (PubChem CID 81433543) has the molecular formula C10H6Cl3NO3S2 and a molecular weight of 358.66 g/mol. Its IUPAC name is 2,5-dichloro-N-(4-chloro-2-hydroxyphenyl)thiophene-3-sulfonamide.
| Compound Name | 2,5-dichloro-N-(4-chloro-2-hydroxyphenyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 81433543 |
| Molecular Formula | C10H6Cl3NO3S2 |
| Molecular Weight | 358.66 g/mol |
| Exact Mass | 356.89 |
| IUPAC Name | 2,5-dichloro-N-(4-chloro-2-hydroxyphenyl)thiophene-3-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Cl)cc1O)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C10H6Cl3NO3S2/c11-5-1-2-6(7(15)3-5)14-19(16,17)8-4-9(12)18-10(8)13/h1-4,14-15H |
| InChIKey | KGUSENKUFIHTFS-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.66 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|