C10H5Cl4NO2S2 — CID 18282859
2,5-dichloro-N-(2,4-dichlorophenyl)thiophene-3-sulfonamide (PubChem CID 18282859) has the molecular formula C10H5Cl4NO2S2 and a molecular weight of 377.10 g/mol. Its IUPAC name is 2,5-dichloro-N-(2,4-dichlorophenyl)thiophene-3-sulfonamide.
| Compound Name | 2,5-dichloro-N-(2,4-dichlorophenyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 18282859 |
| Molecular Formula | C10H5Cl4NO2S2 |
| Molecular Weight | 377.10 g/mol |
| Exact Mass | 374.85 |
| IUPAC Name | 2,5-dichloro-N-(2,4-dichlorophenyl)thiophene-3-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Cl)cc1Cl)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C10H5Cl4NO2S2/c11-5-1-2-7(6(12)3-5)15-19(16,17)8-4-9(13)18-10(8)14/h1-4,15H |
| InChIKey | VBLQAZGTTAVCNL-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.10 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |