C11H6Cl3NO4S2 — CID 43235977
4-chloro-3-[(2,5-dichlorothiophen-3-yl)sulfonylamino]benzoic acid (PubChem CID 43235977) has the molecular formula C11H6Cl3NO4S2 and a molecular weight of 386.67 g/mol. Its IUPAC name is 4-chloro-3-[(2,5-dichlorothiophen-3-yl)sulfonylamino]benzoic acid.
| Compound Name | 4-chloro-3-[(2,5-dichlorothiophen-3-yl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 43235977 |
| Molecular Formula | C11H6Cl3NO4S2 |
| Molecular Weight | 386.67 g/mol |
| Exact Mass | 384.88 |
| IUPAC Name | 4-chloro-3-[(2,5-dichlorothiophen-3-yl)sulfonylamino]benzoic acid |
| SMILES | O=C(O)c1ccc(Cl)c(NS(=O)(=O)c2cc(Cl)sc2Cl)c1 |
| InChI | InChI=1S/C11H6Cl3NO4S2/c12-6-2-1-5(11(16)17)3-7(6)15-21(18,19)8-4-9(13)20-10(8)14/h1-4,15H,(H,16,17) |
| InChIKey | SNRCFRJFBQLQSB-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.67 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |