C11H9ClN2O4S2 — CID 104932565
4-chloro-3-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]benzoic acid (PubChem CID 104932565) has the molecular formula C11H9ClN2O4S2 and a molecular weight of 332.79 g/mol. Its IUPAC name is 4-chloro-3-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]benzoic acid.
| Compound Name | 4-chloro-3-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 104932565 |
| Molecular Formula | C11H9ClN2O4S2 |
| Molecular Weight | 332.79 g/mol |
| Exact Mass | 331.97 |
| IUPAC Name | 4-chloro-3-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]benzoic acid |
| SMILES | Cc1ncc(S(=O)(=O)Nc2cc(C(=O)O)ccc2Cl)s1 |
| InChI | InChI=1S/C11H9ClN2O4S2/c1-6-13-5-10(19-6)20(17,18)14-9-4-7(11(15)16)2-3-8(9)12/h2-5,14H,1H3,(H,15,16) |
| InChIKey | MWOIQYGDDYHUTC-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.79 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |