C12H12N2O5S2 — CID 104589390
5-methoxy-2-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]benzoic acid (PubChem CID 104589390) has the molecular formula C12H12N2O5S2 and a molecular weight of 328.37 g/mol. Its IUPAC name is 5-methoxy-2-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]benzoic acid.
| Compound Name | 5-methoxy-2-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 104589390 |
| Molecular Formula | C12H12N2O5S2 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | 5-methoxy-2-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]benzoic acid |
| SMILES | COc1ccc(NS(=O)(=O)c2cnc(C)s2)c(C(=O)O)c1 |
| InChI | InChI=1S/C12H12N2O5S2/c1-7-13-6-11(20-7)21(17,18)14-10-4-3-8(19-2)5-9(10)12(15)16/h3-6,14H,1-2H3,(H,15,16) |
| InChIKey | UQXCFGBWFJDINH-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |